C27H33BO5 — CID 621282
10,13-dimethyl-2'-phenylspiro[1,2,4,5,6,7,8,9,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-17,4'-1,3,2-dioxaborinane]-3,5',11-trione (PubChem CID 621282) has the molecular formula C27H33BO5 and a molecular weight of 448.37 g/mol. Its IUPAC name is 10,13-dimethyl-2'-phenylspiro[1,2,4,5,6,7,8,9,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-17,4'-1,3,2-dioxaborinane]-3,5',11-trione.
| Compound Name | 10,13-dimethyl-2'-phenylspiro[1,2,4,5,6,7,8,9,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-17,4'-1,3,2-dioxaborinane]-3,5',11-trione |
|---|---|
| PubChem CID | 621282 |
| Molecular Formula | C27H33BO5 |
| Molecular Weight | 448.37 g/mol |
| Exact Mass | 448.24 |
| IUPAC Name | 10,13-dimethyl-2'-phenylspiro[1,2,4,5,6,7,8,9,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-17,4'-1,3,2-dioxaborinane]-3,5',11-trione |
| SMILES | CC12CCC(=O)CC1CCC1C2C(=O)CC2(C)C1CCC21OB(c2ccccc2)OCC1=O |
| InChI | InChI=1S/C27H33BO5/c1-25-12-10-19(29)14-17(25)8-9-20-21-11-13-27(26(21,2)15-22(30)24(20)25)23(31)16-32-28(33-27)18-6-4-3-5-7-18/h3-7,17,20-21,24H,8-16H2,1-2H3 |
| InChIKey | LRPOGISEYMWPLL-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.37 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|