C16H23N3O2 — CID 62128291
2,5-diethoxy-N-[(1-ethylpyrazol-4-yl)methyl]aniline (PubChem CID 62128291) has the molecular formula C16H23N3O2 and a molecular weight of 289.38 g/mol. Its IUPAC name is 2,5-diethoxy-N-[(1-ethylpyrazol-4-yl)methyl]aniline.
| Compound Name | 2,5-diethoxy-N-[(1-ethylpyrazol-4-yl)methyl]aniline |
|---|---|
| PubChem CID | 62128291 |
| Molecular Formula | C16H23N3O2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | 2,5-diethoxy-N-[(1-ethylpyrazol-4-yl)methyl]aniline |
| SMILES | CCOc1ccc(OCC)c(NCc2cnn(CC)c2)c1 |
| InChI | InChI=1S/C16H23N3O2/c1-4-19-12-13(11-18-19)10-17-15-9-14(20-5-2)7-8-16(15)21-6-3/h7-9,11-12,17H,4-6,10H2,1-3H3 |
| InChIKey | HBCCDKXQCHOFDE-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 48.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |