C10H11BrClN3S — CID 62129412
2-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]-4-(chloromethyl)-1,3-thiazole (PubChem CID 62129412) has the molecular formula C10H11BrClN3S and a molecular weight of 320.64 g/mol. Its IUPAC name is 2-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]-4-(chloromethyl)-1,3-thiazole.
| Compound Name | 2-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]-4-(chloromethyl)-1,3-thiazole |
|---|---|
| PubChem CID | 62129412 |
| Molecular Formula | C10H11BrClN3S |
| Molecular Weight | 320.64 g/mol |
| Exact Mass | 318.95 |
| IUPAC Name | 2-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]-4-(chloromethyl)-1,3-thiazole |
| SMILES | Cc1nn(Cc2nc(CCl)cs2)c(C)c1Br |
| InChI | InChI=1S/C10H11BrClN3S/c1-6-10(11)7(2)15(14-6)4-9-13-8(3-12)5-16-9/h5H,3-4H2,1-2H3 |
| InChIKey | UTOAZISWQOYEQG-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.64 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|