C12H14BClN2O2 — CID 62129875
[2-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]phenyl]boronic acid (PubChem CID 62129875) has the molecular formula C12H14BClN2O2 and a molecular weight of 264.52 g/mol. Its IUPAC name is [2-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]phenyl]boronic acid.
| Compound Name | [2-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 62129875 |
| Molecular Formula | C12H14BClN2O2 |
| Molecular Weight | 264.52 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | [2-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]phenyl]boronic acid |
| SMILES | Cc1nn(Cc2ccccc2B(O)O)c(C)c1Cl |
| InChI | InChI=1S/C12H14BClN2O2/c1-8-12(14)9(2)16(15-8)7-10-5-3-4-6-11(10)13(17)18/h3-6,17-18H,7H2,1-2H3 |
| InChIKey | DQFNQEKBGUCMDQ-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.52 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|