C18H32N2O — CID 62130474
2-[3-methyl-N-pentan-3-yl-4-[(propan-2-ylamino)methyl]anilino]ethanol (PubChem CID 62130474) has the molecular formula C18H32N2O and a molecular weight of 292.47 g/mol. Its IUPAC name is 2-[3-methyl-N-pentan-3-yl-4-[(propan-2-ylamino)methyl]anilino]ethanol.
| Compound Name | 2-[3-methyl-N-pentan-3-yl-4-[(propan-2-ylamino)methyl]anilino]ethanol |
|---|---|
| PubChem CID | 62130474 |
| Molecular Formula | C18H32N2O |
| Molecular Weight | 292.47 g/mol |
| Exact Mass | 292.25 |
| IUPAC Name | 2-[3-methyl-N-pentan-3-yl-4-[(propan-2-ylamino)methyl]anilino]ethanol |
| SMILES | CCC(CC)N(CCO)c1ccc(CNC(C)C)c(C)c1 |
| InChI | InChI=1S/C18H32N2O/c1-6-17(7-2)20(10-11-21)18-9-8-16(15(5)12-18)13-19-14(3)4/h8-9,12,14,17,19,21H,6-7,10-11,13H2,1-5H3 |
| InChIKey | ZIFNDVPFXSVKTK-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.47 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|