About N-butyl-N,3-dimethyl-4-[(propan-2-ylamino)methyl]aniline
N-butyl-N,3-dimethyl-4-[(propan-2-ylamino)methyl]aniline (PubChem CID 62135683) has the molecular formula C16H28N2
and a molecular weight of 248.41 g/mol. Its IUPAC name is N-butyl-N,3-dimethyl-4-[(propan-2-ylamino)methyl]aniline.
Molecular Properties
| Compound Name | N-butyl-N,3-dimethyl-4-[(propan-2-ylamino)methyl]aniline |
| PubChem CID | 62135683 |
| Molecular Formula | C16H28N2 |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.23 |
| IUPAC Name | N-butyl-N,3-dimethyl-4-[(propan-2-ylamino)methyl]aniline |
| SMILES | CCCCN(C)c1ccc(CNC(C)C)c(C)c1 |
| InChI | InChI=1S/C16H28N2/c1-6-7-10-18(5)16-9-8-15(14(4)11-16)12-17-13(2)3/h8-9,11,13,17H,6-7,10,12H2,1-5H3 |
| InChIKey | PRTCHKFWOVFDBD-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|
Analyze N-butyl-N,3-dimethyl-4-[(propan-2-ylamino)methyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-N,3-dimethyl-4-[(propan-2-ylamino)methyl]aniline?
The IUPAC name of N-butyl-N,3-dimethyl-4-[(propan-2-ylamino)methyl]aniline (CID 62135683) is N-butyl-N,3-dimethyl-4-[(propan-2-ylamino)methyl]aniline.
What is the SMILES notation for N-butyl-N,3-dimethyl-4-[(propan-2-ylamino)methyl]aniline?
The canonical SMILES for N-butyl-N,3-dimethyl-4-[(propan-2-ylamino)methyl]aniline is CCCCN(C)c1ccc(CNC(C)C)c(C)c1.
What is the InChIKey of N-butyl-N,3-dimethyl-4-[(propan-2-ylamino)methyl]aniline?
The InChIKey is PRTCHKFWOVFDBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28N2/c1-6-7-10-18(5)16-9-8-15(14(4)11-16)12-17-13(2)3/h8-9,11,13,17H,6-7,10,12H2,1-5H3.
What are the key properties of N-butyl-N,3-dimethyl-4-[(propan-2-ylamino)methyl]aniline?
N-butyl-N,3-dimethyl-4-[(propan-2-ylamino)methyl]aniline has a molecular weight of 248.41 g/mol, XLogP of 3.73, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-N,3-dimethyl-4-[(propan-2-ylamino)methyl]aniline is sourced from PubChem (CID 62135683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).