C11H11BrN4S — CID 62130588
2-(4-bromo-3,5-dimethylpyrazol-1-yl)pyridine-3-carbothioamide (PubChem CID 62130588) has the molecular formula C11H11BrN4S and a molecular weight of 311.21 g/mol. Its IUPAC name is 2-(4-bromo-3,5-dimethylpyrazol-1-yl)pyridine-3-carbothioamide.
| Compound Name | 2-(4-bromo-3,5-dimethylpyrazol-1-yl)pyridine-3-carbothioamide |
|---|---|
| PubChem CID | 62130588 |
| Molecular Formula | C11H11BrN4S |
| Molecular Weight | 311.21 g/mol |
| Exact Mass | 309.99 |
| IUPAC Name | 2-(4-bromo-3,5-dimethylpyrazol-1-yl)pyridine-3-carbothioamide |
| SMILES | Cc1nn(-c2ncccc2C(N)=S)c(C)c1Br |
| InChI | InChI=1S/C11H11BrN4S/c1-6-9(12)7(2)16(15-6)11-8(10(13)17)4-3-5-14-11/h3-5H,1-2H3,(H2,13,17) |
| InChIKey | AGOPQYJJHZRLTB-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.21 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|