C9H14BrClN2 — CID 62131028
1-(4-bromobutyl)-4-chloro-3,5-dimethylpyrazole (PubChem CID 62131028) has the molecular formula C9H14BrClN2 and a molecular weight of 265.58 g/mol. Its IUPAC name is 1-(4-bromobutyl)-4-chloro-3,5-dimethylpyrazole.
| Compound Name | 1-(4-bromobutyl)-4-chloro-3,5-dimethylpyrazole |
|---|---|
| PubChem CID | 62131028 |
| Molecular Formula | C9H14BrClN2 |
| Molecular Weight | 265.58 g/mol |
| Exact Mass | 264.00 |
| IUPAC Name | 1-(4-bromobutyl)-4-chloro-3,5-dimethylpyrazole |
| SMILES | Cc1nn(CCCCBr)c(C)c1Cl |
| InChI | InChI=1S/C9H14BrClN2/c1-7-9(11)8(2)13(12-7)6-4-3-5-10/h3-6H2,1-2H3 |
| InChIKey | PAMNMSAOZCVHKB-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.58 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|