C8H12ClN5 — CID 62128688
1-(3-azidopropyl)-4-chloro-3,5-dimethylpyrazole (PubChem CID 62128688) has the molecular formula C8H12ClN5 and a molecular weight of 213.67 g/mol. Its IUPAC name is 1-(3-azidopropyl)-4-chloro-3,5-dimethylpyrazole.
| Compound Name | 1-(3-azidopropyl)-4-chloro-3,5-dimethylpyrazole |
|---|---|
| PubChem CID | 62128688 |
| Molecular Formula | C8H12ClN5 |
| Molecular Weight | 213.67 g/mol |
| Exact Mass | 213.08 |
| IUPAC Name | 1-(3-azidopropyl)-4-chloro-3,5-dimethylpyrazole |
| SMILES | Cc1nn(CCCN=[N+]=[N-])c(C)c1Cl |
| InChI | InChI=1S/C8H12ClN5/c1-6-8(9)7(2)14(12-6)5-3-4-11-13-10/h3-5H2,1-2H3 |
| InChIKey | UHOXSCTWQWYINS-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 66.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.67 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|