C8H13N5 — CID 23005972
4-(2-azidoethyl)-1,3,5-trimethylpyrazole (PubChem CID 23005972) has the molecular formula C8H13N5 and a molecular weight of 179.23 g/mol. Its IUPAC name is 4-(2-azidoethyl)-1,3,5-trimethylpyrazole.
| Compound Name | 4-(2-azidoethyl)-1,3,5-trimethylpyrazole |
|---|---|
| PubChem CID | 23005972 |
| Molecular Formula | C8H13N5 |
| Molecular Weight | 179.23 g/mol |
| Exact Mass | 179.12 |
| IUPAC Name | 4-(2-azidoethyl)-1,3,5-trimethylpyrazole |
| SMILES | Cc1nn(C)c(C)c1CCN=[N+]=[N-] |
| InChI | InChI=1S/C8H13N5/c1-6-8(4-5-10-12-9)7(2)13(3)11-6/h4-5H2,1-3H3 |
| InChIKey | QUJFHKPGPBDAFG-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 66.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.23 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|