C8H15N3O2S — CID 130668312
2-(1,3,5-trimethylpyrazol-4-yl)ethanesulfonamide (PubChem CID 130668312) has the molecular formula C8H15N3O2S and a molecular weight of 217.29 g/mol. Its IUPAC name is 2-(1,3,5-trimethylpyrazol-4-yl)ethanesulfonamide.
| Compound Name | 2-(1,3,5-trimethylpyrazol-4-yl)ethanesulfonamide |
|---|---|
| PubChem CID | 130668312 |
| Molecular Formula | C8H15N3O2S |
| Molecular Weight | 217.29 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | 2-(1,3,5-trimethylpyrazol-4-yl)ethanesulfonamide |
| SMILES | Cc1nn(C)c(C)c1CCS(N)(=O)=O |
| InChI | InChI=1S/C8H15N3O2S/c1-6-8(4-5-14(9,12)13)7(2)11(3)10-6/h4-5H2,1-3H3,(H2,9,12,13) |
| InChIKey | XCVKXLIMVJDQEF-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.29 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |