C16H22ClN3O2S — CID 22207611
N-[3-(4-chloro-3,5-dimethylpyrazol-1-yl)propyl]-2,5-dimethylbenzenesulfonamide (PubChem CID 22207611) has the molecular formula C16H22ClN3O2S and a molecular weight of 355.89 g/mol. Its IUPAC name is N-[3-(4-chloro-3,5-dimethylpyrazol-1-yl)propyl]-2,5-dimethylbenzenesulfonamide.
| Compound Name | N-[3-(4-chloro-3,5-dimethylpyrazol-1-yl)propyl]-2,5-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 22207611 |
| Molecular Formula | C16H22ClN3O2S |
| Molecular Weight | 355.89 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | N-[3-(4-chloro-3,5-dimethylpyrazol-1-yl)propyl]-2,5-dimethylbenzenesulfonamide |
| SMILES | Cc1ccc(C)c(S(=O)(=O)NCCCn2nc(C)c(Cl)c2C)c1 |
| InChI | InChI=1S/C16H22ClN3O2S/c1-11-6-7-12(2)15(10-11)23(21,22)18-8-5-9-20-14(4)16(17)13(3)19-20/h6-7,10,18H,5,8-9H2,1-4H3 |
| InChIKey | YHEPGZBVQFRFJJ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.89 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|