C14H16ClF2N3O2S — CID 22207619
N-[3-(4-chloro-3,5-dimethylpyrazol-1-yl)propyl]-3,4-difluorobenzenesulfonamide (PubChem CID 22207619) has the molecular formula C14H16ClF2N3O2S and a molecular weight of 363.82 g/mol. Its IUPAC name is N-[3-(4-chloro-3,5-dimethylpyrazol-1-yl)propyl]-3,4-difluorobenzenesulfonamide.
| Compound Name | N-[3-(4-chloro-3,5-dimethylpyrazol-1-yl)propyl]-3,4-difluorobenzenesulfonamide |
|---|---|
| PubChem CID | 22207619 |
| Molecular Formula | C14H16ClF2N3O2S |
| Molecular Weight | 363.82 g/mol |
| Exact Mass | 363.06 |
| IUPAC Name | N-[3-(4-chloro-3,5-dimethylpyrazol-1-yl)propyl]-3,4-difluorobenzenesulfonamide |
| SMILES | Cc1nn(CCCNS(=O)(=O)c2ccc(F)c(F)c2)c(C)c1Cl |
| InChI | InChI=1S/C14H16ClF2N3O2S/c1-9-14(15)10(2)20(19-9)7-3-6-18-23(21,22)11-4-5-12(16)13(17)8-11/h4-5,8,18H,3,6-7H2,1-2H3 |
| InChIKey | GZECZSIFBXMTRA-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.82 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|