C14H16N2O3S2 — CID 62131249
4-methyl-5-(3-phenylpyrrolidin-1-yl)sulfonyl-3H-1,3-thiazol-2-one (PubChem CID 62131249) has the molecular formula C14H16N2O3S2 and a molecular weight of 324.43 g/mol. Its IUPAC name is 4-methyl-5-(3-phenylpyrrolidin-1-yl)sulfonyl-3H-1,3-thiazol-2-one.
| Compound Name | 4-methyl-5-(3-phenylpyrrolidin-1-yl)sulfonyl-3H-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 62131249 |
| Molecular Formula | C14H16N2O3S2 |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.06 |
| IUPAC Name | 4-methyl-5-(3-phenylpyrrolidin-1-yl)sulfonyl-3H-1,3-thiazol-2-one |
| SMILES | Cc1[nH]c(=O)sc1S(=O)(=O)N1CCC(c2ccccc2)C1 |
| InChI | InChI=1S/C14H16N2O3S2/c1-10-13(20-14(17)15-10)21(18,19)16-8-7-12(9-16)11-5-3-2-4-6-11/h2-6,12H,7-9H2,1H3,(H,15,17) |
| InChIKey | JQZNGBMPNWZLHR-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 70.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |