C17H21BrN2 — CID 62134209
N-[(3-bromophenyl)methyl]-N,3-dimethyl-4-(methylaminomethyl)aniline (PubChem CID 62134209) has the molecular formula C17H21BrN2 and a molecular weight of 333.27 g/mol. Its IUPAC name is N-[(3-bromophenyl)methyl]-N,3-dimethyl-4-(methylaminomethyl)aniline.
| Compound Name | N-[(3-bromophenyl)methyl]-N,3-dimethyl-4-(methylaminomethyl)aniline |
|---|---|
| PubChem CID | 62134209 |
| Molecular Formula | C17H21BrN2 |
| Molecular Weight | 333.27 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | N-[(3-bromophenyl)methyl]-N,3-dimethyl-4-(methylaminomethyl)aniline |
| SMILES | CNCc1ccc(N(C)Cc2cccc(Br)c2)cc1C |
| InChI | InChI=1S/C17H21BrN2/c1-13-9-17(8-7-15(13)11-19-2)20(3)12-14-5-4-6-16(18)10-14/h4-10,19H,11-12H2,1-3H3 |
| InChIKey | HWKCPABYWAOIOA-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.27 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|