C10H15N5 — CID 62136959
1-ethyl-N-[(1-methylpyrazol-4-yl)methyl]imidazol-2-amine (PubChem CID 62136959) has the molecular formula C10H15N5 and a molecular weight of 205.27 g/mol. Its IUPAC name is 1-ethyl-N-[(1-methylpyrazol-4-yl)methyl]imidazol-2-amine.
| Compound Name | 1-ethyl-N-[(1-methylpyrazol-4-yl)methyl]imidazol-2-amine |
|---|---|
| PubChem CID | 62136959 |
| Molecular Formula | C10H15N5 |
| Molecular Weight | 205.27 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | 1-ethyl-N-[(1-methylpyrazol-4-yl)methyl]imidazol-2-amine |
| SMILES | CCn1ccnc1NCc1cnn(C)c1 |
| InChI | InChI=1S/C10H15N5/c1-3-15-5-4-11-10(15)12-6-9-7-13-14(2)8-9/h4-5,7-8H,3,6H2,1-2H3,(H,11,12) |
| InChIKey | VBQYBGYQJPSSQV-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 47.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.27 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |