C10H7ClF3N — CID 62140302
4-chloro-N-prop-2-ynyl-2-(trifluoromethyl)aniline (PubChem CID 62140302) has the molecular formula C10H7ClF3N and a molecular weight of 233.62 g/mol. Its IUPAC name is 4-chloro-N-prop-2-ynyl-2-(trifluoromethyl)aniline.
| Compound Name | 4-chloro-N-prop-2-ynyl-2-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 62140302 |
| Molecular Formula | C10H7ClF3N |
| Molecular Weight | 233.62 g/mol |
| Exact Mass | 233.02 |
| IUPAC Name | 4-chloro-N-prop-2-ynyl-2-(trifluoromethyl)aniline |
| SMILES | C#CCNc1ccc(Cl)cc1C(F)(F)F |
| InChI | InChI=1S/C10H7ClF3N/c1-2-5-15-9-4-3-7(11)6-8(9)10(12,13)14/h1,3-4,6,15H,5H2 |
| InChIKey | XNNUBWLGIMZVGD-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.62 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|