C11H13ClF3NO2 — CID 63686793
4-chloro-N-(2,2-dimethoxyethyl)-2-(trifluoromethyl)aniline (PubChem CID 63686793) has the molecular formula C11H13ClF3NO2 and a molecular weight of 283.68 g/mol. Its IUPAC name is 4-chloro-N-(2,2-dimethoxyethyl)-2-(trifluoromethyl)aniline.
| Compound Name | 4-chloro-N-(2,2-dimethoxyethyl)-2-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 63686793 |
| Molecular Formula | C11H13ClF3NO2 |
| Molecular Weight | 283.68 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | 4-chloro-N-(2,2-dimethoxyethyl)-2-(trifluoromethyl)aniline |
| SMILES | COC(CNc1ccc(Cl)cc1C(F)(F)F)OC |
| InChI | InChI=1S/C11H13ClF3NO2/c1-17-10(18-2)6-16-9-4-3-7(12)5-8(9)11(13,14)15/h3-5,10,16H,6H2,1-2H3 |
| InChIKey | HJXLMNRJKOIZDO-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.68 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|