C16H13ClN2O — CID 62140788
1-chloro-4-(2,5-dimethylphenoxy)phthalazine (PubChem CID 62140788) has the molecular formula C16H13ClN2O and a molecular weight of 284.75 g/mol. Its IUPAC name is 1-chloro-4-(2,5-dimethylphenoxy)phthalazine.
| Compound Name | 1-chloro-4-(2,5-dimethylphenoxy)phthalazine |
|---|---|
| PubChem CID | 62140788 |
| Molecular Formula | C16H13ClN2O |
| Molecular Weight | 284.75 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | 1-chloro-4-(2,5-dimethylphenoxy)phthalazine |
| SMILES | Cc1ccc(C)c(Oc2nnc(Cl)c3ccccc23)c1 |
| InChI | InChI=1S/C16H13ClN2O/c1-10-7-8-11(2)14(9-10)20-16-13-6-4-3-5-12(13)15(17)18-19-16/h3-9H,1-2H3 |
| InChIKey | MGBXFKYHRQDLOX-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.75 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |