C11H19N3O2S — CID 62152603
6-amino-N-methyl-N-(3-methylbutyl)pyridine-3-sulfonamide (PubChem CID 62152603) has the molecular formula C11H19N3O2S and a molecular weight of 257.36 g/mol. Its IUPAC name is 6-amino-N-methyl-N-(3-methylbutyl)pyridine-3-sulfonamide.
| Compound Name | 6-amino-N-methyl-N-(3-methylbutyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 62152603 |
| Molecular Formula | C11H19N3O2S |
| Molecular Weight | 257.36 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 6-amino-N-methyl-N-(3-methylbutyl)pyridine-3-sulfonamide |
| SMILES | CC(C)CCN(C)S(=O)(=O)c1ccc(N)nc1 |
| InChI | InChI=1S/C11H19N3O2S/c1-9(2)6-7-14(3)17(15,16)10-4-5-11(12)13-8-10/h4-5,8-9H,6-7H2,1-3H3,(H2,12,13) |
| InChIKey | LIUIOQWNYFTXFM-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.36 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |