C14H25N3O2S — CID 79483194
6-amino-N-(2-methylpropyl)-N-pentan-3-ylpyridine-3-sulfonamide (PubChem CID 79483194) has the molecular formula C14H25N3O2S and a molecular weight of 299.44 g/mol. Its IUPAC name is 6-amino-N-(2-methylpropyl)-N-pentan-3-ylpyridine-3-sulfonamide.
| Compound Name | 6-amino-N-(2-methylpropyl)-N-pentan-3-ylpyridine-3-sulfonamide |
|---|---|
| PubChem CID | 79483194 |
| Molecular Formula | C14H25N3O2S |
| Molecular Weight | 299.44 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | 6-amino-N-(2-methylpropyl)-N-pentan-3-ylpyridine-3-sulfonamide |
| SMILES | CCC(CC)N(CC(C)C)S(=O)(=O)c1ccc(N)nc1 |
| InChI | InChI=1S/C14H25N3O2S/c1-5-12(6-2)17(10-11(3)4)20(18,19)13-7-8-14(15)16-9-13/h7-9,11-12H,5-6,10H2,1-4H3,(H2,15,16) |
| InChIKey | IBMSGWMAGVFFSK-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.44 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |