C15H27N3O2S — CID 62152933
N-methyl-N-(4-methylpentan-2-yl)-2-(propylamino)pyridine-3-sulfonamide (PubChem CID 62152933) has the molecular formula C15H27N3O2S and a molecular weight of 313.47 g/mol. Its IUPAC name is N-methyl-N-(4-methylpentan-2-yl)-2-(propylamino)pyridine-3-sulfonamide.
| Compound Name | N-methyl-N-(4-methylpentan-2-yl)-2-(propylamino)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 62152933 |
| Molecular Formula | C15H27N3O2S |
| Molecular Weight | 313.47 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | N-methyl-N-(4-methylpentan-2-yl)-2-(propylamino)pyridine-3-sulfonamide |
| SMILES | CCCNc1ncccc1S(=O)(=O)N(C)C(C)CC(C)C |
| InChI | InChI=1S/C15H27N3O2S/c1-6-9-16-15-14(8-7-10-17-15)21(19,20)18(5)13(4)11-12(2)3/h7-8,10,12-13H,6,9,11H2,1-5H3,(H,16,17) |
| InChIKey | PQISGRCKYPZPJF-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.47 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |