C17H19NO5S2 — CID 6215600
2-[(2Z)-2-(2-ethoxy-2-oxoethylidene)-4-oxo-1,3-thiazolidin-3-yl]ethyl 2-methylsulfanylbenzoate (PubChem CID 6215600) has the molecular formula C17H19NO5S2 and a molecular weight of 381.48 g/mol. Its IUPAC name is 2-[(2Z)-2-(2-ethoxy-2-oxoethylidene)-4-oxo-1,3-thiazolidin-3-yl]ethyl 2-methylsulfanylbenzoate.
| Compound Name | 2-[(2Z)-2-(2-ethoxy-2-oxoethylidene)-4-oxo-1,3-thiazolidin-3-yl]ethyl 2-methylsulfanylbenzoate |
|---|---|
| PubChem CID | 6215600 |
| Molecular Formula | C17H19NO5S2 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.07 |
| IUPAC Name | 2-[(2Z)-2-(2-ethoxy-2-oxoethylidene)-4-oxo-1,3-thiazolidin-3-yl]ethyl 2-methylsulfanylbenzoate |
| SMILES | CCOC(=O)/C=C1\SCC(=O)N1CCOC(=O)c1ccccc1SC |
| InChI | InChI=1S/C17H19NO5S2/c1-3-22-16(20)10-15-18(14(19)11-25-15)8-9-23-17(21)12-6-4-5-7-13(12)24-2/h4-7,10H,3,8-9,11H2,1-2H3/b15-10- |
| InChIKey | XNUWSUJKQCZIIL-GDNBJRDFSA-N |
| XLogP | 2.55 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|