C15H23N3O2S — CID 62157554
2-(ethylamino)-N-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl)benzenesulfonamide (PubChem CID 62157554) has the molecular formula C15H23N3O2S and a molecular weight of 309.44 g/mol. Its IUPAC name is 2-(ethylamino)-N-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl)benzenesulfonamide.
| Compound Name | 2-(ethylamino)-N-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 62157554 |
| Molecular Formula | C15H23N3O2S |
| Molecular Weight | 309.44 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | 2-(ethylamino)-N-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl)benzenesulfonamide |
| SMILES | CCNc1ccccc1S(=O)(=O)NC1CCN2CCCC12 |
| InChI | InChI=1S/C15H23N3O2S/c1-2-16-13-6-3-4-8-15(13)21(19,20)17-12-9-11-18-10-5-7-14(12)18/h3-4,6,8,12,14,16-17H,2,5,7,9-11H2,1H3 |
| InChIKey | PMDVJAFKXHENHQ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.44 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |