C13H19N5O2S — CID 62158845
N-[(1-methylpyrazol-4-yl)methyl]-6-(propylamino)pyridine-3-sulfonamide (PubChem CID 62158845) has the molecular formula C13H19N5O2S and a molecular weight of 309.40 g/mol. Its IUPAC name is N-[(1-methylpyrazol-4-yl)methyl]-6-(propylamino)pyridine-3-sulfonamide.
| Compound Name | N-[(1-methylpyrazol-4-yl)methyl]-6-(propylamino)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 62158845 |
| Molecular Formula | C13H19N5O2S |
| Molecular Weight | 309.40 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | N-[(1-methylpyrazol-4-yl)methyl]-6-(propylamino)pyridine-3-sulfonamide |
| SMILES | CCCNc1ccc(S(=O)(=O)NCc2cnn(C)c2)cn1 |
| InChI | InChI=1S/C13H19N5O2S/c1-3-6-14-13-5-4-12(9-15-13)21(19,20)17-8-11-7-16-18(2)10-11/h4-5,7,9-10,17H,3,6,8H2,1-2H3,(H,14,15) |
| InChIKey | MKCLYOQLBUEAQO-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.40 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |