C14H23BrN4O — CID 62160177
2-amino-5-bromo-N-[2-(dimethylamino)ethyl]-N-(2-methylpropyl)pyridine-3-carboxamide (PubChem CID 62160177) has the molecular formula C14H23BrN4O and a molecular weight of 343.27 g/mol. Its IUPAC name is 2-amino-5-bromo-N-[2-(dimethylamino)ethyl]-N-(2-methylpropyl)pyridine-3-carboxamide.
| Compound Name | 2-amino-5-bromo-N-[2-(dimethylamino)ethyl]-N-(2-methylpropyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 62160177 |
| Molecular Formula | C14H23BrN4O |
| Molecular Weight | 343.27 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | 2-amino-5-bromo-N-[2-(dimethylamino)ethyl]-N-(2-methylpropyl)pyridine-3-carboxamide |
| SMILES | CC(C)CN(CCN(C)C)C(=O)c1cc(Br)cnc1N |
| InChI | InChI=1S/C14H23BrN4O/c1-10(2)9-19(6-5-18(3)4)14(20)12-7-11(15)8-17-13(12)16/h7-8,10H,5-6,9H2,1-4H3,(H2,16,17) |
| InChIKey | JPFFGFVYWYGOTI-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.27 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |