C14H21Cl2N3O — CID 114917935
2,5-dichloro-N-[2-(dimethylamino)ethyl]-N-(2-methylpropyl)pyridine-4-carboxamide (PubChem CID 114917935) has the molecular formula C14H21Cl2N3O and a molecular weight of 318.25 g/mol. Its IUPAC name is 2,5-dichloro-N-[2-(dimethylamino)ethyl]-N-(2-methylpropyl)pyridine-4-carboxamide.
| Compound Name | 2,5-dichloro-N-[2-(dimethylamino)ethyl]-N-(2-methylpropyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 114917935 |
| Molecular Formula | C14H21Cl2N3O |
| Molecular Weight | 318.25 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | 2,5-dichloro-N-[2-(dimethylamino)ethyl]-N-(2-methylpropyl)pyridine-4-carboxamide |
| SMILES | CC(C)CN(CCN(C)C)C(=O)c1cc(Cl)ncc1Cl |
| InChI | InChI=1S/C14H21Cl2N3O/c1-10(2)9-19(6-5-18(3)4)14(20)11-7-13(16)17-8-12(11)15/h7-8,10H,5-6,9H2,1-4H3 |
| InChIKey | SDUZSNCFIRTZIZ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.25 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|