C14H19ClN4O — CID 114922574
5-chloro-N-(2-cyanoethyl)-2-(methylamino)-N-(2-methylpropyl)pyridine-4-carboxamide (PubChem CID 114922574) has the molecular formula C14H19ClN4O and a molecular weight of 294.79 g/mol. Its IUPAC name is 5-chloro-N-(2-cyanoethyl)-2-(methylamino)-N-(2-methylpropyl)pyridine-4-carboxamide.
| Compound Name | 5-chloro-N-(2-cyanoethyl)-2-(methylamino)-N-(2-methylpropyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 114922574 |
| Molecular Formula | C14H19ClN4O |
| Molecular Weight | 294.79 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 5-chloro-N-(2-cyanoethyl)-2-(methylamino)-N-(2-methylpropyl)pyridine-4-carboxamide |
| SMILES | CNc1cc(C(=O)N(CCC#N)CC(C)C)c(Cl)cn1 |
| InChI | InChI=1S/C14H19ClN4O/c1-10(2)9-19(6-4-5-16)14(20)11-7-13(17-3)18-8-12(11)15/h7-8,10H,4,6,9H2,1-3H3,(H,17,18) |
| InChIKey | ZCKRIOSSACGZPZ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 69.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.79 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |