C10H11ClF3N3O — CID 62160336
2-amino-6-chloro-N-ethyl-N-(2,2,2-trifluoroethyl)pyridine-4-carboxamide (PubChem CID 62160336) has the molecular formula C10H11ClF3N3O and a molecular weight of 281.67 g/mol. Its IUPAC name is 2-amino-6-chloro-N-ethyl-N-(2,2,2-trifluoroethyl)pyridine-4-carboxamide.
| Compound Name | 2-amino-6-chloro-N-ethyl-N-(2,2,2-trifluoroethyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 62160336 |
| Molecular Formula | C10H11ClF3N3O |
| Molecular Weight | 281.67 g/mol |
| Exact Mass | 281.05 |
| IUPAC Name | 2-amino-6-chloro-N-ethyl-N-(2,2,2-trifluoroethyl)pyridine-4-carboxamide |
| SMILES | CCN(CC(F)(F)F)C(=O)c1cc(N)nc(Cl)c1 |
| InChI | InChI=1S/C10H11ClF3N3O/c1-2-17(5-10(12,13)14)9(18)6-3-7(11)16-8(15)4-6/h3-4H,2,5H2,1H3,(H2,15,16) |
| InChIKey | FADJDLYDDKMBMX-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.67 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|