C13H21ClN4O — CID 62161613
6-amino-3-chloro-N-[2-(dimethylamino)ethyl]-N-propylpyridine-2-carboxamide (PubChem CID 62161613) has the molecular formula C13H21ClN4O and a molecular weight of 284.79 g/mol. Its IUPAC name is 6-amino-3-chloro-N-[2-(dimethylamino)ethyl]-N-propylpyridine-2-carboxamide.
| Compound Name | 6-amino-3-chloro-N-[2-(dimethylamino)ethyl]-N-propylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 62161613 |
| Molecular Formula | C13H21ClN4O |
| Molecular Weight | 284.79 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | 6-amino-3-chloro-N-[2-(dimethylamino)ethyl]-N-propylpyridine-2-carboxamide |
| SMILES | CCCN(CCN(C)C)C(=O)c1nc(N)ccc1Cl |
| InChI | InChI=1S/C13H21ClN4O/c1-4-7-18(9-8-17(2)3)13(19)12-10(14)5-6-11(15)16-12/h5-6H,4,7-9H2,1-3H3,(H2,15,16) |
| InChIKey | JWQGMLYBSIRHFK-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.79 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |