C12H18ClN3O3 — CID 55042057
6-amino-3-chloro-N,N-bis(2-methoxyethyl)pyridine-2-carboxamide (PubChem CID 55042057) has the molecular formula C12H18ClN3O3 and a molecular weight of 287.75 g/mol. Its IUPAC name is 6-amino-3-chloro-N,N-bis(2-methoxyethyl)pyridine-2-carboxamide.
| Compound Name | 6-amino-3-chloro-N,N-bis(2-methoxyethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 55042057 |
| Molecular Formula | C12H18ClN3O3 |
| Molecular Weight | 287.75 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | 6-amino-3-chloro-N,N-bis(2-methoxyethyl)pyridine-2-carboxamide |
| SMILES | COCCN(CCOC)C(=O)c1nc(N)ccc1Cl |
| InChI | InChI=1S/C12H18ClN3O3/c1-18-7-5-16(6-8-19-2)12(17)11-9(13)3-4-10(14)15-11/h3-4H,5-8H2,1-2H3,(H2,14,15) |
| InChIKey | PLKURCXCRCVKKY-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 77.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.75 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |