C13H16BrN3O2 — CID 62163085
2-[5-(3-bromo-4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]-N-ethylethanamine (PubChem CID 62163085) has the molecular formula C13H16BrN3O2 and a molecular weight of 326.19 g/mol. Its IUPAC name is 2-[5-(3-bromo-4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]-N-ethylethanamine.
| Compound Name | 2-[5-(3-bromo-4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]-N-ethylethanamine |
|---|---|
| PubChem CID | 62163085 |
| Molecular Formula | C13H16BrN3O2 |
| Molecular Weight | 326.19 g/mol |
| Exact Mass | 325.04 |
| IUPAC Name | 2-[5-(3-bromo-4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]-N-ethylethanamine |
| SMILES | CCNCCc1nnc(-c2ccc(OC)c(Br)c2)o1 |
| InChI | InChI=1S/C13H16BrN3O2/c1-3-15-7-6-12-16-17-13(19-12)9-4-5-11(18-2)10(14)8-9/h4-5,8,15H,3,6-7H2,1-2H3 |
| InChIKey | LACFHECRFNIJGZ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.19 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|