C12H14IN3O — CID 62164274
N-ethyl-1-[5-(2-iodophenyl)-1,3,4-oxadiazol-2-yl]ethanamine (PubChem CID 62164274) has the molecular formula C12H14IN3O and a molecular weight of 343.17 g/mol. Its IUPAC name is N-ethyl-1-[5-(2-iodophenyl)-1,3,4-oxadiazol-2-yl]ethanamine.
| Compound Name | N-ethyl-1-[5-(2-iodophenyl)-1,3,4-oxadiazol-2-yl]ethanamine |
|---|---|
| PubChem CID | 62164274 |
| Molecular Formula | C12H14IN3O |
| Molecular Weight | 343.17 g/mol |
| Exact Mass | 343.02 |
| IUPAC Name | N-ethyl-1-[5-(2-iodophenyl)-1,3,4-oxadiazol-2-yl]ethanamine |
| SMILES | CCNC(C)c1nnc(-c2ccccc2I)o1 |
| InChI | InChI=1S/C12H14IN3O/c1-3-14-8(2)11-15-16-12(17-11)9-6-4-5-7-10(9)13/h4-8,14H,3H2,1-2H3 |
| InChIKey | QXMZKLTYSWNXSD-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.17 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|