C13H15IN2O — CID 65181348
N-ethyl-1-[5-(2-iodophenyl)-1,3-oxazol-2-yl]ethanamine (PubChem CID 65181348) has the molecular formula C13H15IN2O and a molecular weight of 342.18 g/mol. Its IUPAC name is N-ethyl-1-[5-(2-iodophenyl)-1,3-oxazol-2-yl]ethanamine.
| Compound Name | N-ethyl-1-[5-(2-iodophenyl)-1,3-oxazol-2-yl]ethanamine |
|---|---|
| PubChem CID | 65181348 |
| Molecular Formula | C13H15IN2O |
| Molecular Weight | 342.18 g/mol |
| Exact Mass | 342.02 |
| IUPAC Name | N-ethyl-1-[5-(2-iodophenyl)-1,3-oxazol-2-yl]ethanamine |
| SMILES | CCNC(C)c1ncc(-c2ccccc2I)o1 |
| InChI | InChI=1S/C13H15IN2O/c1-3-15-9(2)13-16-8-12(17-13)10-6-4-5-7-11(10)14/h4-9,15H,3H2,1-2H3 |
| InChIKey | KRWXKIUQEFTWTO-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.18 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|