C11H13ClN2O2 — CID 106690342
1-[5-(5-chlorofuran-2-yl)-1,3-oxazol-2-yl]-N-ethylethanamine (PubChem CID 106690342) has the molecular formula C11H13ClN2O2 and a molecular weight of 240.69 g/mol. Its IUPAC name is 1-[5-(5-chlorofuran-2-yl)-1,3-oxazol-2-yl]-N-ethylethanamine.
| Compound Name | 1-[5-(5-chlorofuran-2-yl)-1,3-oxazol-2-yl]-N-ethylethanamine |
|---|---|
| PubChem CID | 106690342 |
| Molecular Formula | C11H13ClN2O2 |
| Molecular Weight | 240.69 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | 1-[5-(5-chlorofuran-2-yl)-1,3-oxazol-2-yl]-N-ethylethanamine |
| SMILES | CCNC(C)c1ncc(-c2ccc(Cl)o2)o1 |
| InChI | InChI=1S/C11H13ClN2O2/c1-3-13-7(2)11-14-6-9(16-11)8-4-5-10(12)15-8/h4-7,13H,3H2,1-2H3 |
| InChIKey | CBVLSZTZFHVEKJ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 51.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.69 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |