C13H14Br2N2O — CID 114375998
1-[5-(2,5-dibromophenyl)-1,3-oxazol-2-yl]-N-ethylethanamine (PubChem CID 114375998) has the molecular formula C13H14Br2N2O and a molecular weight of 374.08 g/mol. Its IUPAC name is 1-[5-(2,5-dibromophenyl)-1,3-oxazol-2-yl]-N-ethylethanamine.
| Compound Name | 1-[5-(2,5-dibromophenyl)-1,3-oxazol-2-yl]-N-ethylethanamine |
|---|---|
| PubChem CID | 114375998 |
| Molecular Formula | C13H14Br2N2O |
| Molecular Weight | 374.08 g/mol |
| Exact Mass | 371.95 |
| IUPAC Name | 1-[5-(2,5-dibromophenyl)-1,3-oxazol-2-yl]-N-ethylethanamine |
| SMILES | CCNC(C)c1ncc(-c2cc(Br)ccc2Br)o1 |
| InChI | InChI=1S/C13H14Br2N2O/c1-3-16-8(2)13-17-7-12(18-13)10-6-9(14)4-5-11(10)15/h4-8,16H,3H2,1-2H3 |
| InChIKey | ZJJQMQAQKMYUKZ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.08 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |