C13H19N3O2 — CID 62170253
(2-ethylmorpholin-4-yl)-[2-(methylamino)-3-pyridinyl]methanone (PubChem CID 62170253) has the molecular formula C13H19N3O2 and a molecular weight of 249.31 g/mol. Its IUPAC name is (2-ethylmorpholin-4-yl)-[2-(methylamino)-3-pyridinyl]methanone.
| Compound Name | (2-ethylmorpholin-4-yl)-[2-(methylamino)-3-pyridinyl]methanone |
|---|---|
| PubChem CID | 62170253 |
| Molecular Formula | C13H19N3O2 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | (2-ethylmorpholin-4-yl)-[2-(methylamino)-3-pyridinyl]methanone |
| SMILES | CCC1CN(C(=O)c2cccnc2NC)CCO1 |
| InChI | InChI=1S/C13H19N3O2/c1-3-10-9-16(7-8-18-10)13(17)11-5-4-6-15-12(11)14-2/h4-6,10H,3,7-9H2,1-2H3,(H,14,15) |
| InChIKey | UQQGIRHENCNDKW-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |