C17H28N4O6 — CID 154910507
[6-[(dimethylamino)methyl]-1,4-oxazepan-4-yl]-[2-(methylamino)-3-pyridinyl]methanone;formic acid (PubChem CID 154910507) has the molecular formula C17H28N4O6 and a molecular weight of 384.43 g/mol. Its IUPAC name is [6-[(dimethylamino)methyl]-1,4-oxazepan-4-yl]-[2-(methylamino)-3-pyridinyl]methanone;formic acid.
| Compound Name | [6-[(dimethylamino)methyl]-1,4-oxazepan-4-yl]-[2-(methylamino)-3-pyridinyl]methanone;formic acid |
|---|---|
| PubChem CID | 154910507 |
| Molecular Formula | C17H28N4O6 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | [6-[(dimethylamino)methyl]-1,4-oxazepan-4-yl]-[2-(methylamino)-3-pyridinyl]methanone;formic acid |
| SMILES | CNc1ncccc1C(=O)N1CCOCC(CN(C)C)C1.O=CO.O=CO |
| InChI | InChI=1S/C15H24N4O2.2CH2O2/c1-16-14-13(5-4-6-17-14)15(20)19-7-8-21-11-12(10-19)9-18(2)3;2*2-1-3/h4-6,12H,7-11H2,1-3H3,(H,16,17);2*1H,(H,2,3) |
| InChIKey | OXAWUNFKTWERFF-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 132.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|