C15H22ClN3O4 — CID 154907358
(5-chloro-2-pyridinyl)-[6-[(dimethylamino)methyl]-1,4-oxazepan-4-yl]methanone;formic acid (PubChem CID 154907358) has the molecular formula C15H22ClN3O4 and a molecular weight of 343.81 g/mol. Its IUPAC name is (5-chloro-2-pyridinyl)-[6-[(dimethylamino)methyl]-1,4-oxazepan-4-yl]methanone;formic acid.
| Compound Name | (5-chloro-2-pyridinyl)-[6-[(dimethylamino)methyl]-1,4-oxazepan-4-yl]methanone;formic acid |
|---|---|
| PubChem CID | 154907358 |
| Molecular Formula | C15H22ClN3O4 |
| Molecular Weight | 343.81 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | (5-chloro-2-pyridinyl)-[6-[(dimethylamino)methyl]-1,4-oxazepan-4-yl]methanone;formic acid |
| SMILES | CN(C)CC1COCCN(C(=O)c2ccc(Cl)cn2)C1.O=CO |
| InChI | InChI=1S/C14H20ClN3O2.CH2O2/c1-17(2)8-11-9-18(5-6-20-10-11)14(19)13-4-3-12(15)7-16-13;2-1-3/h3-4,7,11H,5-6,8-10H2,1-2H3;1H,(H,2,3) |
| InChIKey | XJTRDVPRUJVPGF-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 82.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.81 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|