C9H14N4O2 — CID 62180605
N-(2-hydroxyethyl)-N-methyl-6-(methylamino)pyridazine-3-carboxamide (PubChem CID 62180605) has the molecular formula C9H14N4O2 and a molecular weight of 210.24 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-N-methyl-6-(methylamino)pyridazine-3-carboxamide.
| Compound Name | N-(2-hydroxyethyl)-N-methyl-6-(methylamino)pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 62180605 |
| Molecular Formula | C9H14N4O2 |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | N-(2-hydroxyethyl)-N-methyl-6-(methylamino)pyridazine-3-carboxamide |
| SMILES | CNc1ccc(C(=O)N(C)CCO)nn1 |
| InChI | InChI=1S/C9H14N4O2/c1-10-8-4-3-7(11-12-8)9(15)13(2)5-6-14/h3-4,14H,5-6H2,1-2H3,(H,10,12) |
| InChIKey | URIYZTIIEVDUCG-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |