C8H11FN4O — CID 130504947
N-(2-fluoroethyl)-6-(methylamino)pyridazine-3-carboxamide (PubChem CID 130504947) has the molecular formula C8H11FN4O and a molecular weight of 198.20 g/mol. Its IUPAC name is N-(2-fluoroethyl)-6-(methylamino)pyridazine-3-carboxamide.
| Compound Name | N-(2-fluoroethyl)-6-(methylamino)pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 130504947 |
| Molecular Formula | C8H11FN4O |
| Molecular Weight | 198.20 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | N-(2-fluoroethyl)-6-(methylamino)pyridazine-3-carboxamide |
| SMILES | CNc1ccc(C(=O)NCCF)nn1 |
| InChI | InChI=1S/C8H11FN4O/c1-10-7-3-2-6(12-13-7)8(14)11-5-4-9/h2-3H,4-5H2,1H3,(H,10,13)(H,11,14) |
| InChIKey | DFZZIYLPWXOFAD-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.20 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |