C13H17N3OS2 — CID 62188803
4-[(2-methoxyphenyl)sulfanylmethyl]-N-propylthiadiazol-5-amine (PubChem CID 62188803) has the molecular formula C13H17N3OS2 and a molecular weight of 295.43 g/mol. Its IUPAC name is 4-[(2-methoxyphenyl)sulfanylmethyl]-N-propylthiadiazol-5-amine.
| Compound Name | 4-[(2-methoxyphenyl)sulfanylmethyl]-N-propylthiadiazol-5-amine |
|---|---|
| PubChem CID | 62188803 |
| Molecular Formula | C13H17N3OS2 |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | 4-[(2-methoxyphenyl)sulfanylmethyl]-N-propylthiadiazol-5-amine |
| SMILES | CCCNc1snnc1CSc1ccccc1OC |
| InChI | InChI=1S/C13H17N3OS2/c1-3-8-14-13-10(15-16-19-13)9-18-12-7-5-4-6-11(12)17-2/h4-7,14H,3,8-9H2,1-2H3 |
| InChIKey | FQDSYFSUCVRCKJ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |