C20H13FN2O3 — CID 6219304
2-(3-fluorophenoxy)-N-[(E)-(2-oxoacenaphthylen-1-ylidene)amino]acetamide (PubChem CID 6219304) has the molecular formula C20H13FN2O3 and a molecular weight of 348.33 g/mol. Its IUPAC name is 2-(3-fluorophenoxy)-N-[(E)-(2-oxoacenaphthylen-1-ylidene)amino]acetamide.
| Compound Name | 2-(3-fluorophenoxy)-N-[(E)-(2-oxoacenaphthylen-1-ylidene)amino]acetamide |
|---|---|
| PubChem CID | 6219304 |
| Molecular Formula | C20H13FN2O3 |
| Molecular Weight | 348.33 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | 2-(3-fluorophenoxy)-N-[(E)-(2-oxoacenaphthylen-1-ylidene)amino]acetamide |
| SMILES | O=C(COc1cccc(F)c1)N/N=C1/C(=O)c2cccc3cccc1c23 |
| InChI | InChI=1S/C20H13FN2O3/c21-13-6-3-7-14(10-13)26-11-17(24)22-23-19-15-8-1-4-12-5-2-9-16(18(12)15)20(19)25/h1-10H,11H2,(H,22,24)/b23-19+ |
| InChIKey | HBEAMASERKZUAI-FCDQGJHFSA-N |
| XLogP | 3.07 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.33 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|