C11H8F5N3OS — CID 62193628
N-ethyl-4-[(2,3,4,5,6-pentafluorophenoxy)methyl]thiadiazol-5-amine (PubChem CID 62193628) has the molecular formula C11H8F5N3OS and a molecular weight of 325.26 g/mol. Its IUPAC name is N-ethyl-4-[(2,3,4,5,6-pentafluorophenoxy)methyl]thiadiazol-5-amine.
| Compound Name | N-ethyl-4-[(2,3,4,5,6-pentafluorophenoxy)methyl]thiadiazol-5-amine |
|---|---|
| PubChem CID | 62193628 |
| Molecular Formula | C11H8F5N3OS |
| Molecular Weight | 325.26 g/mol |
| Exact Mass | 325.03 |
| IUPAC Name | N-ethyl-4-[(2,3,4,5,6-pentafluorophenoxy)methyl]thiadiazol-5-amine |
| SMILES | CCNc1snnc1COc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C11H8F5N3OS/c1-2-17-11-4(18-19-21-11)3-20-10-8(15)6(13)5(12)7(14)9(10)16/h17H,2-3H2,1H3 |
| InChIKey | UCYZSBZBGWOYNF-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.26 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|