C12H11F4N3OS — CID 103290199
N-propyl-4-[(2,3,5,6-tetrafluorophenoxy)methyl]thiadiazol-5-amine (PubChem CID 103290199) has the molecular formula C12H11F4N3OS and a molecular weight of 321.30 g/mol. Its IUPAC name is N-propyl-4-[(2,3,5,6-tetrafluorophenoxy)methyl]thiadiazol-5-amine.
| Compound Name | N-propyl-4-[(2,3,5,6-tetrafluorophenoxy)methyl]thiadiazol-5-amine |
|---|---|
| PubChem CID | 103290199 |
| Molecular Formula | C12H11F4N3OS |
| Molecular Weight | 321.30 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | N-propyl-4-[(2,3,5,6-tetrafluorophenoxy)methyl]thiadiazol-5-amine |
| SMILES | CCCNc1snnc1COc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C12H11F4N3OS/c1-2-3-17-12-8(18-19-21-12)5-20-11-9(15)6(13)4-7(14)10(11)16/h4,17H,2-3,5H2,1H3 |
| InChIKey | NPDBDBHPFMAQLU-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.30 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|