C14H19N3OS — CID 55045166
4-[(3-ethylphenoxy)methyl]-N-propylthiadiazol-5-amine (PubChem CID 55045166) has the molecular formula C14H19N3OS and a molecular weight of 277.39 g/mol. Its IUPAC name is 4-[(3-ethylphenoxy)methyl]-N-propylthiadiazol-5-amine.
| Compound Name | 4-[(3-ethylphenoxy)methyl]-N-propylthiadiazol-5-amine |
|---|---|
| PubChem CID | 55045166 |
| Molecular Formula | C14H19N3OS |
| Molecular Weight | 277.39 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | 4-[(3-ethylphenoxy)methyl]-N-propylthiadiazol-5-amine |
| SMILES | CCCNc1snnc1COc1cccc(CC)c1 |
| InChI | InChI=1S/C14H19N3OS/c1-3-8-15-14-13(16-17-19-14)10-18-12-7-5-6-11(4-2)9-12/h5-7,9,15H,3-4,8,10H2,1-2H3 |
| InChIKey | OCRQYFVXFSEWEC-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.39 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |