C12H14N2O2 — CID 64765480
3-[(3-ethylphenoxy)methyl]-4-methyl-1,2,5-oxadiazole (PubChem CID 64765480) has the molecular formula C12H14N2O2 and a molecular weight of 218.26 g/mol. Its IUPAC name is 3-[(3-ethylphenoxy)methyl]-4-methyl-1,2,5-oxadiazole.
| Compound Name | 3-[(3-ethylphenoxy)methyl]-4-methyl-1,2,5-oxadiazole |
|---|---|
| PubChem CID | 64765480 |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 3-[(3-ethylphenoxy)methyl]-4-methyl-1,2,5-oxadiazole |
| SMILES | CCc1cccc(OCc2nonc2C)c1 |
| InChI | InChI=1S/C12H14N2O2/c1-3-10-5-4-6-11(7-10)15-8-12-9(2)13-16-14-12/h4-7H,3,8H2,1-2H3 |
| InChIKey | XJXICEJIHCLUOT-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |