C13H14F3NO — CID 6219497
(E)-1,1,1-trifluoro-4-(1-phenylethylamino)pent-3-en-2-one (PubChem CID 6219497) has the molecular formula C13H14F3NO and a molecular weight of 257.25 g/mol. Its IUPAC name is (E)-1,1,1-trifluoro-4-(1-phenylethylamino)pent-3-en-2-one.
| Compound Name | (E)-1,1,1-trifluoro-4-(1-phenylethylamino)pent-3-en-2-one |
|---|---|
| PubChem CID | 6219497 |
| Molecular Formula | C13H14F3NO |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | (E)-1,1,1-trifluoro-4-(1-phenylethylamino)pent-3-en-2-one |
| SMILES | C/C(=C\C(=O)C(F)(F)F)NC(C)c1ccccc1 |
| InChI | InChI=1S/C13H14F3NO/c1-9(8-12(18)13(14,15)16)17-10(2)11-6-4-3-5-7-11/h3-8,10,17H,1-2H3/b9-8+ |
| InChIKey | OUOWCFZLVJYNHV-CMDGGOBGSA-N |
| XLogP | 3.37 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|