C18H13N5O4S — CID 6219676
2-imidazo[2,1-b][1,3]thiazol-6-yl-N-[(Z)-[5-(4-nitrophenyl)furan-2-yl]methylideneamino]acetamide (PubChem CID 6219676) has the molecular formula C18H13N5O4S and a molecular weight of 395.40 g/mol. Its IUPAC name is 2-imidazo[2,1-b][1,3]thiazol-6-yl-N-[(Z)-[5-(4-nitrophenyl)furan-2-yl]methylideneamino]acetamide.
| Compound Name | 2-imidazo[2,1-b][1,3]thiazol-6-yl-N-[(Z)-[5-(4-nitrophenyl)furan-2-yl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 6219676 |
| Molecular Formula | C18H13N5O4S |
| Molecular Weight | 395.40 g/mol |
| Exact Mass | 395.07 |
| IUPAC Name | 2-imidazo[2,1-b][1,3]thiazol-6-yl-N-[(Z)-[5-(4-nitrophenyl)furan-2-yl]methylideneamino]acetamide |
| SMILES | O=C(Cc1cn2ccsc2n1)N/N=C\c1ccc(-c2ccc([N+](=O)[O-])cc2)o1 |
| InChI | InChI=1S/C18H13N5O4S/c24-17(9-13-11-22-7-8-28-18(22)20-13)21-19-10-15-5-6-16(27-15)12-1-3-14(4-2-12)23(25)26/h1-8,10-11H,9H2,(H,21,24)/b19-10- |
| InChIKey | KPRIRWNTJXZOKB-GRSHGNNSSA-N |
| XLogP | 3.26 |
| TPSA | 115.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.40 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|