C14H22Br2N2O — CID 62198718
2-(4,5-dibromofuran-2-yl)-2-(4-propylpiperidin-1-yl)ethanamine (PubChem CID 62198718) has the molecular formula C14H22Br2N2O and a molecular weight of 394.15 g/mol. Its IUPAC name is 2-(4,5-dibromofuran-2-yl)-2-(4-propylpiperidin-1-yl)ethanamine.
| Compound Name | 2-(4,5-dibromofuran-2-yl)-2-(4-propylpiperidin-1-yl)ethanamine |
|---|---|
| PubChem CID | 62198718 |
| Molecular Formula | C14H22Br2N2O |
| Molecular Weight | 394.15 g/mol |
| Exact Mass | 392.01 |
| IUPAC Name | 2-(4,5-dibromofuran-2-yl)-2-(4-propylpiperidin-1-yl)ethanamine |
| SMILES | CCCC1CCN(C(CN)c2cc(Br)c(Br)o2)CC1 |
| InChI | InChI=1S/C14H22Br2N2O/c1-2-3-10-4-6-18(7-5-10)12(9-17)13-8-11(15)14(16)19-13/h8,10,12H,2-7,9,17H2,1H3 |
| InChIKey | IFSAKPWCWVKCHL-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 42.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.15 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |